C23H20N2O4 — CID 166155571
N-[4-[2-[amino(hydroxy)methyl]phenoxy]phenyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 166155571) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[4-[2-[amino(hydroxy)methyl]phenoxy]phenyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[2-[amino(hydroxy)methyl]phenoxy]phenyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 166155571 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[4-[2-[amino(hydroxy)methyl]phenoxy]phenyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Oc3ccccc3C(N)O)cc2)oc2ccccc12 |
| InChI | InChI=1S/C23H20N2O4/c1-14-17-6-2-4-8-19(17)29-21(14)23(27)25-15-10-12-16(13-11-15)28-20-9-5-3-7-18(20)22(24)26/h2-13,22,26H,24H2,1H3,(H,25,27) |
| InChIKey | XRCMKALSVVKRDO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|