C17H13F2NO2S — CID 7944836
N-[4-(difluoromethylsulfanyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 7944836) has the molecular formula C17H13F2NO2S and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7944836 |
| Molecular Formula | C17H13F2NO2S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(SC(F)F)cc2)oc2ccccc12 |
| InChI | InChI=1S/C17H13F2NO2S/c1-10-13-4-2-3-5-14(13)22-15(10)16(21)20-11-6-8-12(9-7-11)23-17(18)19/h2-9,17H,1H3,(H,20,21) |
| InChIKey | LCMMYKLIICGXEW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |