C20H18ClN3O4 — CID 60556151
methyl 2-[[2-[4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]acetyl]amino]acetate (PubChem CID 60556151) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 60556151 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl 2-[[2-[4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H18ClN3O4/c1-28-19(26)11-22-18(25)8-12-2-5-15(6-3-12)23-20(27)17-10-13-9-14(21)4-7-16(13)24-17/h2-7,9-10,24H,8,11H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | WRLXNTGHGYTLGA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |