C18H16ClN3O3 — CID 55556002
N-(3-acetamido-4-methoxyphenyl)-5-chloro-1H-indole-2-carboxamide (PubChem CID 55556002) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-(3-acetamido-4-methoxyphenyl)-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-(3-acetamido-4-methoxyphenyl)-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55556002 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(3-acetamido-4-methoxyphenyl)-5-chloro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1NC(C)=O |
| InChI | InChI=1S/C18H16ClN3O3/c1-10(23)20-15-9-13(4-6-17(15)25-2)21-18(24)16-8-11-7-12(19)3-5-14(11)22-16/h3-9,22H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | SSALVSVSTAFMIQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |