C17H14ClFN2O3 — CID 7679189
N-(3-chloro-4-fluorophenyl)-5,6-dimethoxy-1H-indole-2-carboxamide (PubChem CID 7679189) has the molecular formula C17H14ClFN2O3 and a molecular weight of 348.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5,6-dimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5,6-dimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 7679189 |
| Molecular Formula | C17H14ClFN2O3 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5,6-dimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)Nc3ccc(F)c(Cl)c3)[nH]c2cc1OC |
| InChI | InChI=1S/C17H14ClFN2O3/c1-23-15-6-9-5-14(21-13(9)8-16(15)24-2)17(22)20-10-3-4-12(19)11(18)7-10/h3-8,21H,1-2H3,(H,20,22) |
| InChIKey | QUKIYNVSDACWCY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |