C7H4Cl2F2O — CID 118824754
1,2-dichloro-4-fluoro-5-(fluoromethoxy)benzene (PubChem CID 118824754) has the molecular formula C7H4Cl2F2O and a molecular weight of 213.01 g/mol. Its IUPAC name is 1,2-dichloro-4-fluoro-5-(fluoromethoxy)benzene.
| Compound Name | 1,2-dichloro-4-fluoro-5-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 118824754 |
| Molecular Formula | C7H4Cl2F2O |
| Molecular Weight | 213.01 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | 1,2-dichloro-4-fluoro-5-(fluoromethoxy)benzene |
| SMILES | FCOc1cc(Cl)c(Cl)cc1F |
| InChI | InChI=1S/C7H4Cl2F2O/c8-4-1-6(11)7(12-3-10)2-5(4)9/h1-2H,3H2 |
| InChIKey | ARFQWIUFADCVQL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.01 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|