C19H27ClO6 — CID 5347945
diethyl 2-[2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]ethyl]propanedioate (PubChem CID 5347945) has the molecular formula C19H27ClO6 and a molecular weight of 386.87 g/mol. Its IUPAC name is diethyl 2-[2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]ethyl]propanedioate.
| Compound Name | diethyl 2-[2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]ethyl]propanedioate |
|---|---|
| PubChem CID | 5347945 |
| Molecular Formula | C19H27ClO6 |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | diethyl 2-[2-[2-(4-chloro-2,6-dimethylphenoxy)ethoxy]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCOCCOc1c(C)cc(Cl)cc1C)C(=O)OCC |
| InChI | InChI=1S/C19H27ClO6/c1-5-24-18(21)16(19(22)25-6-2)7-8-23-9-10-26-17-13(3)11-15(20)12-14(17)4/h11-12,16H,5-10H2,1-4H3 |
| InChIKey | GGVHBOQJMVPTQK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|