C17H23ClO5 — CID 2266460
diethyl 2-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]propanedioate (PubChem CID 2266460) has the molecular formula C17H23ClO5 and a molecular weight of 342.82 g/mol. Its IUPAC name is diethyl 2-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]propanedioate.
| Compound Name | diethyl 2-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]propanedioate |
|---|---|
| PubChem CID | 2266460 |
| Molecular Formula | C17H23ClO5 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | diethyl 2-[2-(4-chloro-2,6-dimethylphenoxy)ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCOc1c(C)cc(Cl)cc1C)C(=O)OCC |
| InChI | InChI=1S/C17H23ClO5/c1-5-21-16(19)14(17(20)22-6-2)7-8-23-15-11(3)9-13(18)10-12(15)4/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | WPEUYDHGGKVCGH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|