C28H38O6 — CID 59749621
dimethyl (2S,3R)-2,3-bis[2-(2,4,6-trimethylphenoxy)ethyl]butanedioate (PubChem CID 59749621) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3-bis[2-(2,4,6-trimethylphenoxy)ethyl]butanedioate.
| Compound Name | dimethyl (2S,3R)-2,3-bis[2-(2,4,6-trimethylphenoxy)ethyl]butanedioate |
|---|---|
| PubChem CID | 59749621 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | dimethyl (2S,3R)-2,3-bis[2-(2,4,6-trimethylphenoxy)ethyl]butanedioate |
| SMILES | COC(=O)[C@@H](CCOc1c(C)cc(C)cc1C)[C@@H](CCOc1c(C)cc(C)cc1C)C(=O)OC |
| InChI | InChI=1S/C28H38O6/c1-17-13-19(3)25(20(4)14-17)33-11-9-23(27(29)31-7)24(28(30)32-8)10-12-34-26-21(5)15-18(2)16-22(26)6/h13-16,23-24H,9-12H2,1-8H3/t23-,24+ |
| InChIKey | FEAXAYFMIWZQGD-PSWAGMNNSA-N |
| XLogP | 5.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |