About butane;1-(2-phenylethoxy)-4-propylbenzene
butane;1-(2-phenylethoxy)-4-propylbenzene (PubChem CID 142957775) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is butane;1-(2-phenylethoxy)-4-propylbenzene.
Molecular Properties
| Compound Name | butane;1-(2-phenylethoxy)-4-propylbenzene |
| PubChem CID | 142957775 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | butane;1-(2-phenylethoxy)-4-propylbenzene |
| SMILES | CCCC.CCCc1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O.C4H10/c1-2-6-15-9-11-17(12-10-15)18-14-13-16-7-4-3-5-8-16;1-3-4-2/h3-5,7-12H,2,6,13-14H2,1H3;3-4H2,1-2H3 |
| InChIKey | AMWZJRBPKZWAGZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;1-(2-phenylethoxy)-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-(2-phenylethoxy)-4-propylbenzene?
The IUPAC name of butane;1-(2-phenylethoxy)-4-propylbenzene (CID 142957775) is butane;1-(2-phenylethoxy)-4-propylbenzene.
What is the SMILES notation for butane;1-(2-phenylethoxy)-4-propylbenzene?
The canonical SMILES for butane;1-(2-phenylethoxy)-4-propylbenzene is CCCC.CCCc1ccc(OCCc2ccccc2)cc1.
What is the InChIKey of butane;1-(2-phenylethoxy)-4-propylbenzene?
The InChIKey is AMWZJRBPKZWAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O.C4H10/c1-2-6-15-9-11-17(12-10-15)18-14-13-16-7-4-3-5-8-16;1-3-4-2/h3-5,7-12H,2,6,13-14H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;1-(2-phenylethoxy)-4-propylbenzene?
butane;1-(2-phenylethoxy)-4-propylbenzene has a molecular weight of 298.47 g/mol, XLogP of 6.07, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-(2-phenylethoxy)-4-propylbenzene is sourced from PubChem (CID 142957775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).