About 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride
1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride (PubChem CID 67939398) has the molecular formula C18H27F5OS
and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride.
Molecular Properties
| Compound Name | 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride |
| PubChem CID | 67939398 |
| Molecular Formula | C18H27F5OS |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride |
| SMILES | CCCCOc1ccc(CCSc2ccccc2)cc1.F.F.F.F.F |
| InChI | InChI=1S/C18H22OS.5FH/c1-2-3-14-19-17-11-9-16(10-12-17)13-15-20-18-7-5-4-6-8-18;;;;;/h4-12H,2-3,13-15H2,1H3;5*1H |
| InChIKey | JSALHLTUONGSJJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride?
The IUPAC name of 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride (CID 67939398) is 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride.
What is the SMILES notation for 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride?
The canonical SMILES for 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride is CCCCOc1ccc(CCSc2ccccc2)cc1.F.F.F.F.F.
What is the InChIKey of 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride?
The InChIKey is JSALHLTUONGSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22OS.5FH/c1-2-3-14-19-17-11-9-16(10-12-17)13-15-20-18-7-5-4-6-8-18;;;;;/h4-12H,2-3,13-15H2,1H3;5*1H.
What are the key properties of 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride?
1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride has a molecular weight of 386.47 g/mol, XLogP of 5.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-4-(2-phenylsulfanylethyl)benzene;pentahydrofluoride is sourced from PubChem (CID 67939398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).