C24H26I2O3 — CID 158061033
(2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-(3-methylbutoxy)phenyl]methanone (PubChem CID 158061033) has the molecular formula C24H26I2O3 and a molecular weight of 616.28 g/mol. Its IUPAC name is (2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-(3-methylbutoxy)phenyl]methanone.
| Compound Name | (2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-(3-methylbutoxy)phenyl]methanone |
|---|---|
| PubChem CID | 158061033 |
| Molecular Formula | C24H26I2O3 |
| Molecular Weight | 616.28 g/mol |
| Exact Mass | 616.00 |
| IUPAC Name | (2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-(3-methylbutoxy)phenyl]methanone |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCC(C)C)c(I)c1 |
| InChI | InChI=1S/C24H26I2O3/c1-4-5-9-21-22(17-8-6-7-10-20(17)29-21)23(27)16-13-18(25)24(19(26)14-16)28-12-11-15(2)3/h6-8,10,13-15H,4-5,9,11-12H2,1-3H3 |
| InChIKey | FKQJXOUNJAAQFW-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.28 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|