C37H50N2O8S2 — CID 19754398
N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]methanesulfonamide;4-methylbenzenesulfonic acid (PubChem CID 19754398) has the molecular formula C37H50N2O8S2 and a molecular weight of 714.95 g/mol. Its IUPAC name is N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]methanesulfonamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]methanesulfonamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19754398 |
| Molecular Formula | C37H50N2O8S2 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]methanesulfonamide;4-methylbenzenesulfonic acid |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(C(C)C)oc3ccc(NS(C)(=O)=O)cc23)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C30H42N2O5S.C7H8O3S/c1-6-8-17-32(18-9-7-2)19-10-20-36-25-14-11-23(12-15-25)29(33)28-26-21-24(31-38(5,34)35)13-16-27(26)37-30(28)22(3)4;1-6-2-4-7(5-3-6)11(8,9)10/h11-16,21-22,31H,6-10,17-20H2,1-5H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | KKZQYUCJNRPAKA-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|