C38H52N2O8S2 — CID 19754270
N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]-N-methylmethanesulfonamide;4-methylbenzenesulfonic acid (PubChem CID 19754270) has the molecular formula C38H52N2O8S2 and a molecular weight of 728.97 g/mol. Its IUPAC name is N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]-N-methylmethanesulfonamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]-N-methylmethanesulfonamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19754270 |
| Molecular Formula | C38H52N2O8S2 |
| Molecular Weight | 728.97 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | N-[3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-propan-2-yl-1-benzofuran-5-yl]-N-methylmethanesulfonamide;4-methylbenzenesulfonic acid |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(C(C)C)oc3ccc(N(C)S(C)(=O)=O)cc23)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H44N2O5S.C7H8O3S/c1-7-9-18-33(19-10-8-2)20-11-21-37-26-15-12-24(13-16-26)30(34)29-27-22-25(32(5)39(6,35)36)14-17-28(27)38-31(29)23(3)4;1-6-2-4-7(5-3-6)11(8,9)10/h12-17,22-23H,7-11,18-21H2,1-6H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | JSSIXSAYZFCRKE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.97 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|