C21H23NO5S — CID 158215415
CID 158215415 (PubChem CID 158215415) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol.
| Compound Name | CID 158215415 |
|---|---|
| PubChem CID | 158215415 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | — |
| SMILES | CCCCOc1ccc(C(=O)c2c(C)oc3ccc(C)cc23)cc1.N=S(=O)=O |
| InChI | InChI=1S/C21H22O3.HNO2S/c1-4-5-12-23-17-9-7-16(8-10-17)21(22)20-15(3)24-19-11-6-14(2)13-18(19)20;1-4(2)3/h6-11,13H,4-5,12H2,1-3H3;1H |
| InChIKey | GCOWPXHEWNBABJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|