C32H38N2O2 — CID 12844816
[4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone (PubChem CID 12844816) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is [4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone.
| Compound Name | [4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone |
|---|---|
| PubChem CID | 12844816 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(-c3ccccc3)cc3ccccn23)cc1 |
| InChI | InChI=1S/C32H38N2O2/c1-3-5-20-33(21-6-4-2)22-12-24-36-29-18-16-27(17-19-29)32(35)31-30(26-13-8-7-9-14-26)25-28-15-10-11-23-34(28)31/h7-11,13-19,23,25H,3-6,12,20-22,24H2,1-2H3 |
| InChIKey | WCXVFYISWJFMOA-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|