C26H35ClN2O — CID 16733875
[4-[4-(diethylamino)butyl]phenyl]-(2-propylindolizin-3-yl)methanone;hydrochloride (PubChem CID 16733875) has the molecular formula C26H35ClN2O and a molecular weight of 427.03 g/mol. Its IUPAC name is [4-[4-(diethylamino)butyl]phenyl]-(2-propylindolizin-3-yl)methanone;hydrochloride.
| Compound Name | [4-[4-(diethylamino)butyl]phenyl]-(2-propylindolizin-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 16733875 |
| Molecular Formula | C26H35ClN2O |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [4-[4-(diethylamino)butyl]phenyl]-(2-propylindolizin-3-yl)methanone;hydrochloride |
| SMILES | CCCc1cc2ccccn2c1C(=O)c1ccc(CCCCN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C26H34N2O.ClH/c1-4-11-23-20-24-13-8-10-19-28(24)25(23)26(29)22-16-14-21(15-17-22)12-7-9-18-27(5-2)6-3;/h8,10,13-17,19-20H,4-7,9,11-12,18H2,1-3H3;1H |
| InChIKey | DFJITGQKHMFYNX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|