C28H36Cl2N2O2 — CID 13069480
[2,3-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-ethylindolizin-3-yl)methanone (PubChem CID 13069480) has the molecular formula C28H36Cl2N2O2 and a molecular weight of 503.51 g/mol. Its IUPAC name is [2,3-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-ethylindolizin-3-yl)methanone.
| Compound Name | [2,3-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-ethylindolizin-3-yl)methanone |
|---|---|
| PubChem CID | 13069480 |
| Molecular Formula | C28H36Cl2N2O2 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | [2,3-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-ethylindolizin-3-yl)methanone |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(CC)cc3ccccn23)c(Cl)c1Cl |
| InChI | InChI=1S/C28H36Cl2N2O2/c1-4-7-15-31(16-8-5-2)17-11-19-34-24-14-13-23(25(29)26(24)30)28(33)27-21(6-3)20-22-12-9-10-18-32(22)27/h9-10,12-14,18,20H,4-8,11,15-17,19H2,1-3H3 |
| InChIKey | ZQYWTXJXZHMUGO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|