C31H44N2O5S — CID 66653298
N-[6-butyl-7-[4-[3-(dibutylamino)propoxy]benzoyl]cyclopenta[c]pyran-5-yl]methanesulfonamide (PubChem CID 66653298) has the molecular formula C31H44N2O5S and a molecular weight of 556.77 g/mol. Its IUPAC name is N-[6-butyl-7-[4-[3-(dibutylamino)propoxy]benzoyl]cyclopenta[c]pyran-5-yl]methanesulfonamide.
| Compound Name | N-[6-butyl-7-[4-[3-(dibutylamino)propoxy]benzoyl]cyclopenta[c]pyran-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 66653298 |
| Molecular Formula | C31H44N2O5S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | N-[6-butyl-7-[4-[3-(dibutylamino)propoxy]benzoyl]cyclopenta[c]pyran-5-yl]methanesulfonamide |
| SMILES | CCCCc1c(NS(C)(=O)=O)c2ccocc-2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C31H44N2O5S/c1-5-8-12-27-29(28-23-37-22-17-26(28)30(27)32-39(4,35)36)31(34)24-13-15-25(16-14-24)38-21-11-20-33(18-9-6-2)19-10-7-3/h13-17,22-23,32H,5-12,18-21H2,1-4H3 |
| InChIKey | YIFFFPCNAGRNKI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|