C25H22N2O4 — CID 102234991
(4,5-diphenyl-1H-imidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 102234991) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (4,5-diphenyl-1H-imidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4,5-diphenyl-1H-imidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 102234991 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (4,5-diphenyl-1H-imidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O4/c1-29-19-14-18(15-20(30-2)24(19)31-3)23(28)25-26-21(16-10-6-4-7-11-16)22(27-25)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,26,27) |
| InChIKey | YTJMCNPJFJMAMC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |