C27H23N3O3 — CID 1370169
3-[5-phenyl-2-(3,4,5-trimethoxyphenyl)-1H-imidazol-4-yl]quinoline (PubChem CID 1370169) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[5-phenyl-2-(3,4,5-trimethoxyphenyl)-1H-imidazol-4-yl]quinoline.
| Compound Name | 3-[5-phenyl-2-(3,4,5-trimethoxyphenyl)-1H-imidazol-4-yl]quinoline |
|---|---|
| PubChem CID | 1370169 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[5-phenyl-2-(3,4,5-trimethoxyphenyl)-1H-imidazol-4-yl]quinoline |
| SMILES | COc1cc(-c2nc(-c3cnc4ccccc4c3)c(-c3ccccc3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C27H23N3O3/c1-31-22-14-19(15-23(32-2)26(22)33-3)27-29-24(17-9-5-4-6-10-17)25(30-27)20-13-18-11-7-8-12-21(18)28-16-20/h4-16H,1-3H3,(H,29,30) |
| InChIKey | VEGVBINOVWWKHL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |