C27H29N3O6 — CID 44604780
2-[4,5-bis(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]-3-methylpyridine (PubChem CID 44604780) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[4,5-bis(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]-3-methylpyridine.
| Compound Name | 2-[4,5-bis(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]-3-methylpyridine |
|---|---|
| PubChem CID | 44604780 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[4,5-bis(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]-3-methylpyridine |
| SMILES | COc1cc(-c2nc(-c3ncccc3C)[nH]c2-c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H29N3O6/c1-15-9-8-10-28-22(15)27-29-23(16-11-18(31-2)25(35-6)19(12-16)32-3)24(30-27)17-13-20(33-4)26(36-7)21(14-17)34-5/h8-14H,1-7H3,(H,29,30) |
| InChIKey | PZIQYPAXQOJNEC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|