C17H19N5O3 — CID 155557243
5-[2-amino-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]pyridin-2-amine (PubChem CID 155557243) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[2-amino-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]pyridin-2-amine.
| Compound Name | 5-[2-amino-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 155557243 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-[2-amino-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]pyridin-2-amine |
| SMILES | COc1cc(-c2nc(N)[nH]c2-c2ccc(N)nc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N5O3/c1-23-11-6-10(7-12(24-2)16(11)25-3)15-14(21-17(19)22-15)9-4-5-13(18)20-8-9/h4-8H,1-3H3,(H2,18,20)(H3,19,21,22) |
| InChIKey | SQWCDGKGASEGEW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |