C26H26N2O6 — CID 67888868
[2-(3-amino-4-methoxyphenyl)-4-(hydroxymethyl)-1H-indol-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 67888868) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [2-(3-amino-4-methoxyphenyl)-4-(hydroxymethyl)-1H-indol-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [2-(3-amino-4-methoxyphenyl)-4-(hydroxymethyl)-1H-indol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 67888868 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [2-(3-amino-4-methoxyphenyl)-4-(hydroxymethyl)-1H-indol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(-c2[nH]c3cccc(CO)c3c2C(=O)c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C26H26N2O6/c1-31-19-9-8-14(10-17(19)27)24-23(22-15(13-29)6-5-7-18(22)28-24)25(30)16-11-20(32-2)26(34-4)21(12-16)33-3/h5-12,28-29H,13,27H2,1-4H3 |
| InChIKey | OCKUNRDDKLCDNT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|