C17H19NO5S — CID 58360131
S-(3,4,5-trimethoxyphenyl) 3-amino-4-(hydroxymethyl)benzenecarbothioate (PubChem CID 58360131) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is S-(3,4,5-trimethoxyphenyl) 3-amino-4-(hydroxymethyl)benzenecarbothioate.
| Compound Name | S-(3,4,5-trimethoxyphenyl) 3-amino-4-(hydroxymethyl)benzenecarbothioate |
|---|---|
| PubChem CID | 58360131 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | S-(3,4,5-trimethoxyphenyl) 3-amino-4-(hydroxymethyl)benzenecarbothioate |
| SMILES | COc1cc(SC(=O)c2ccc(CO)c(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO5S/c1-21-14-7-12(8-15(22-2)16(14)23-3)24-17(20)10-4-5-11(9-19)13(18)6-10/h4-8,19H,9,18H2,1-3H3 |
| InChIKey | BPENRHHQVUUJTK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|