C19H21ClN2O6 — CID 9079285
[2-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl] 3-amino-4-chlorobenzoate (PubChem CID 9079285) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is [2-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9079285 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]ethyl] 3-amino-4-chlorobenzoate |
| SMILES | COc1cc(CNC(=O)COC(=O)c2ccc(Cl)c(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21ClN2O6/c1-25-15-6-11(7-16(26-2)18(15)27-3)9-22-17(23)10-28-19(24)12-4-5-13(20)14(21)8-12/h4-8H,9-10,21H2,1-3H3,(H,22,23) |
| InChIKey | NDINCOLWGKKRPY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|