C19H21ClN2O5 — CID 9079210
[2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 9079210) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9079210 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)COC(=O)c2ccc(Cl)c(N)c2)c1 |
| InChI | InChI=1S/C19H21ClN2O5/c1-11(14-9-13(25-2)5-7-17(14)26-3)22-18(23)10-27-19(24)12-4-6-15(20)16(21)8-12/h4-9,11H,10,21H2,1-3H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | NCHYRVSMEGKNGW-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|