C20H21NO6 — CID 9019768
[2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 9019768) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 9019768 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [2-[[(1S)-1-(2,5-dimethoxyphenyl)ethyl]amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)COC(=O)c2ccc(C=O)cc2)c1 |
| InChI | InChI=1S/C20H21NO6/c1-13(17-10-16(25-2)8-9-18(17)26-3)21-19(23)12-27-20(24)15-6-4-14(11-22)5-7-15/h4-11,13H,12H2,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | CRDWBNKQIRJVED-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|