C19H20N2O7 — CID 8640953
N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-formyl-2-nitrophenoxy)acetamide (PubChem CID 8640953) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-formyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-formyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 8640953 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-formyl-2-nitrophenoxy)acetamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)COc2ccc(C=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N2O7/c1-12(15-9-14(26-2)5-7-17(15)27-3)20-19(23)11-28-18-6-4-13(10-22)8-16(18)21(24)25/h4-10,12H,11H2,1-3H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | HLJFPCKXHMBZBL-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|