C19H20N2O8 — CID 8641036
2-(4-formyl-2-nitrophenoxy)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 8641036) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-(4-formyl-2-nitrophenoxy)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(4-formyl-2-nitrophenoxy)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8641036 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(4-formyl-2-nitrophenoxy)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)COc1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O8/c1-26-16-8-18(28-3)17(27-2)7-13(16)9-20-19(23)11-29-15-5-4-12(10-22)6-14(15)21(24)25/h4-8,10H,9,11H2,1-3H3,(H,20,23) |
| InChIKey | TUPVJKOJZGFJAW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|