C21H24N2O5 — CID 8641009
N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2-(4-formyl-2-nitrophenoxy)acetamide (PubChem CID 8641009) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2-(4-formyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2-(4-formyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 8641009 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2-(4-formyl-2-nitrophenoxy)acetamide |
| SMILES | CCc1ccc([C@H](NC(=O)COc2ccc(C=O)cc2[N+](=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-4-15-5-8-17(9-6-15)21(14(2)3)22-20(25)13-28-19-10-7-16(12-24)11-18(19)23(26)27/h5-12,14,21H,4,13H2,1-3H3,(H,22,25)/t21-/m1/s1 |
| InChIKey | GIFCXTIVJBAESY-OAQYLSRUSA-N |
| XLogP | 3.86 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|