C14H14N2O4S — CID 4749807
S-pyrimidin-2-yl 3,4,5-trimethoxybenzenecarbothioate (PubChem CID 4749807) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is S-pyrimidin-2-yl 3,4,5-trimethoxybenzenecarbothioate.
| Compound Name | S-pyrimidin-2-yl 3,4,5-trimethoxybenzenecarbothioate |
|---|---|
| PubChem CID | 4749807 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | S-pyrimidin-2-yl 3,4,5-trimethoxybenzenecarbothioate |
| SMILES | COc1cc(C(=O)Sc2ncccn2)cc(OC)c1OC |
| InChI | InChI=1S/C14H14N2O4S/c1-18-10-7-9(8-11(19-2)12(10)20-3)13(17)21-14-15-5-4-6-16-14/h4-8H,1-3H3 |
| InChIKey | OBGRSJFZRIAAAP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|