C19H16N2O3S — CID 4570711
S-(4-phenylpyrimidin-2-yl) 3,5-dimethoxybenzenecarbothioate (PubChem CID 4570711) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is S-(4-phenylpyrimidin-2-yl) 3,5-dimethoxybenzenecarbothioate.
| Compound Name | S-(4-phenylpyrimidin-2-yl) 3,5-dimethoxybenzenecarbothioate |
|---|---|
| PubChem CID | 4570711 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | S-(4-phenylpyrimidin-2-yl) 3,5-dimethoxybenzenecarbothioate |
| SMILES | COc1cc(OC)cc(C(=O)Sc2nccc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H16N2O3S/c1-23-15-10-14(11-16(12-15)24-2)18(22)25-19-20-9-8-17(21-19)13-6-4-3-5-7-13/h3-12H,1-2H3 |
| InChIKey | WLAHYRJDOIYHQY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|