C17H10N4O5S — CID 71900145
S-(4-phenylpyrimidin-2-yl) 3,5-dinitrobenzenecarbothioate (PubChem CID 71900145) has the molecular formula C17H10N4O5S and a molecular weight of 382.36 g/mol. Its IUPAC name is S-(4-phenylpyrimidin-2-yl) 3,5-dinitrobenzenecarbothioate.
| Compound Name | S-(4-phenylpyrimidin-2-yl) 3,5-dinitrobenzenecarbothioate |
|---|---|
| PubChem CID | 71900145 |
| Molecular Formula | C17H10N4O5S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | S-(4-phenylpyrimidin-2-yl) 3,5-dinitrobenzenecarbothioate |
| SMILES | O=C(Sc1nccc(-c2ccccc2)n1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10N4O5S/c22-16(12-8-13(20(23)24)10-14(9-12)21(25)26)27-17-18-7-6-15(19-17)11-4-2-1-3-5-11/h1-10H |
| InChIKey | JOAQCLBMOPHZOG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 129.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|