C28H36ClN3O2 — CID 175223781
5-[1-(2-chloropiperidin-1-yl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole (PubChem CID 175223781) has the molecular formula C28H36ClN3O2 and a molecular weight of 482.07 g/mol. Its IUPAC name is 5-[1-(2-chloropiperidin-1-yl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole.
| Compound Name | 5-[1-(2-chloropiperidin-1-yl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole |
|---|---|
| PubChem CID | 175223781 |
| Molecular Formula | C28H36ClN3O2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 5-[1-(2-chloropiperidin-1-yl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole |
| SMILES | CCc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccc(C3CCN(N4CCCCC4Cl)CC3)cc12 |
| InChI | InChI=1S/C28H36ClN3O2/c1-4-22-23-17-20(19-12-15-31(16-13-19)32-14-6-5-7-27(32)29)8-10-24(23)30-28(22)21-9-11-25(33-2)26(18-21)34-3/h8-11,17-19,27,30H,4-7,12-16H2,1-3H3 |
| InChIKey | BUMRHQIYFOUNCS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|