C28H37N3 — CID 161065761
5-(1-cyclohexylpiperidin-4-yl)-2-(2-methyl-4-pyridinyl)-3-propan-2-yl-1H-indole (PubChem CID 161065761) has the molecular formula C28H37N3 and a molecular weight of 415.63 g/mol. Its IUPAC name is 5-(1-cyclohexylpiperidin-4-yl)-2-(2-methyl-4-pyridinyl)-3-propan-2-yl-1H-indole.
| Compound Name | 5-(1-cyclohexylpiperidin-4-yl)-2-(2-methyl-4-pyridinyl)-3-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 161065761 |
| Molecular Formula | C28H37N3 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.30 |
| IUPAC Name | 5-(1-cyclohexylpiperidin-4-yl)-2-(2-methyl-4-pyridinyl)-3-propan-2-yl-1H-indole |
| SMILES | Cc1cc(-c2[nH]c3ccc(C4CCN(C5CCCCC5)CC4)cc3c2C(C)C)ccn1 |
| InChI | InChI=1S/C28H37N3/c1-19(2)27-25-18-22(21-12-15-31(16-13-21)24-7-5-4-6-8-24)9-10-26(25)30-28(27)23-11-14-29-20(3)17-23/h9-11,14,17-19,21,24,30H,4-8,12-13,15-16H2,1-3H3 |
| InChIKey | UDZQUKLVHFDJLB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |