C27H35FN4 — CID 134330036
2-(2-fluoro-4-pyridinyl)-5-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]-3-propan-2-yl-1H-indole (PubChem CID 134330036) has the molecular formula C27H35FN4 and a molecular weight of 434.60 g/mol. Its IUPAC name is 2-(2-fluoro-4-pyridinyl)-5-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]-3-propan-2-yl-1H-indole.
| Compound Name | 2-(2-fluoro-4-pyridinyl)-5-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]-3-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 134330036 |
| Molecular Formula | C27H35FN4 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-(2-fluoro-4-pyridinyl)-5-[1-(1-methylpiperidin-4-yl)piperidin-4-yl]-3-propan-2-yl-1H-indole |
| SMILES | CC(C)c1c(-c2ccnc(F)c2)[nH]c2ccc(C3CCN(C4CCN(C)CC4)CC3)cc12 |
| InChI | InChI=1S/C27H35FN4/c1-18(2)26-23-16-20(4-5-24(23)30-27(26)21-6-11-29-25(28)17-21)19-7-14-32(15-8-19)22-9-12-31(3)13-10-22/h4-6,11,16-19,22,30H,7-10,12-15H2,1-3H3 |
| InChIKey | USVWDJZKWLCKPU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|