C23H24N2O — CID 142594360
2-(1-benzofuran-2-yl)-3-ethyl-5-piperidin-4-yl-1H-indole (PubChem CID 142594360) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-ethyl-5-piperidin-4-yl-1H-indole.
| Compound Name | 2-(1-benzofuran-2-yl)-3-ethyl-5-piperidin-4-yl-1H-indole |
|---|---|
| PubChem CID | 142594360 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-ethyl-5-piperidin-4-yl-1H-indole |
| SMILES | CCc1c(-c2cc3ccccc3o2)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C23H24N2O/c1-2-18-19-13-16(15-9-11-24-12-10-15)7-8-20(19)25-23(18)22-14-17-5-3-4-6-21(17)26-22/h3-8,13-15,24-25H,2,9-12H2,1H3 |
| InChIKey | TUNBEABBBHWMSP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|