C25H30N4 — CID 175038513
3-ethyl-5-[1-[(1-methylpyrrol-2-yl)methyl]piperidin-4-yl]-2-(1H-pyrrol-3-yl)-1H-indole (PubChem CID 175038513) has the molecular formula C25H30N4 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-ethyl-5-[1-[(1-methylpyrrol-2-yl)methyl]piperidin-4-yl]-2-(1H-pyrrol-3-yl)-1H-indole.
| Compound Name | 3-ethyl-5-[1-[(1-methylpyrrol-2-yl)methyl]piperidin-4-yl]-2-(1H-pyrrol-3-yl)-1H-indole |
|---|---|
| PubChem CID | 175038513 |
| Molecular Formula | C25H30N4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 3-ethyl-5-[1-[(1-methylpyrrol-2-yl)methyl]piperidin-4-yl]-2-(1H-pyrrol-3-yl)-1H-indole |
| SMILES | CCc1c(-c2cc[nH]c2)[nH]c2ccc(C3CCN(Cc4cccn4C)CC3)cc12 |
| InChI | InChI=1S/C25H30N4/c1-3-22-23-15-19(6-7-24(23)27-25(22)20-8-11-26-16-20)18-9-13-29(14-10-18)17-21-5-4-12-28(21)2/h4-8,11-12,15-16,18,26-27H,3,9-10,13-14,17H2,1-2H3 |
| InChIKey | IYIXREBEKYAZKM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 39.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |