C30H41ClN4O — CID 134329820
2-(2-chloro-5-methoxy-4-pyridinyl)-3-ethyl-5-[1-[1-(2-methylpropyl)piperidin-4-yl]piperidin-4-yl]-1H-indole (PubChem CID 134329820) has the molecular formula C30H41ClN4O and a molecular weight of 509.14 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxy-4-pyridinyl)-3-ethyl-5-[1-[1-(2-methylpropyl)piperidin-4-yl]piperidin-4-yl]-1H-indole.
| Compound Name | 2-(2-chloro-5-methoxy-4-pyridinyl)-3-ethyl-5-[1-[1-(2-methylpropyl)piperidin-4-yl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 134329820 |
| Molecular Formula | C30H41ClN4O |
| Molecular Weight | 509.14 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-(2-chloro-5-methoxy-4-pyridinyl)-3-ethyl-5-[1-[1-(2-methylpropyl)piperidin-4-yl]piperidin-4-yl]-1H-indole |
| SMILES | CCc1c(-c2cc(Cl)ncc2OC)[nH]c2ccc(C3CCN(C4CCN(CC(C)C)CC4)CC3)cc12 |
| InChI | InChI=1S/C30H41ClN4O/c1-5-24-25-16-22(6-7-27(25)33-30(24)26-17-29(31)32-18-28(26)36-4)21-8-14-35(15-9-21)23-10-12-34(13-11-23)19-20(2)3/h6-7,16-18,20-21,23,33H,5,8-15,19H2,1-4H3 |
| InChIKey | BTGWTCCFXPDVSF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.14 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|