C33H47N3O3 — CID 142283581
2-(3,4-dimethoxyphenyl)-5-[1-[1-(5-methoxypentyl)piperidin-4-yl]piperidin-4-yl]-3-methyl-1H-indole (PubChem CID 142283581) has the molecular formula C33H47N3O3 and a molecular weight of 533.76 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[1-[1-(5-methoxypentyl)piperidin-4-yl]piperidin-4-yl]-3-methyl-1H-indole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[1-[1-(5-methoxypentyl)piperidin-4-yl]piperidin-4-yl]-3-methyl-1H-indole |
|---|---|
| PubChem CID | 142283581 |
| Molecular Formula | C33H47N3O3 |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[1-[1-(5-methoxypentyl)piperidin-4-yl]piperidin-4-yl]-3-methyl-1H-indole |
| SMILES | COCCCCCN1CCC(N2CCC(c3ccc4[nH]c(-c5ccc(OC)c(OC)c5)c(C)c4c3)CC2)CC1 |
| InChI | InChI=1S/C33H47N3O3/c1-24-29-22-26(8-10-30(29)34-33(24)27-9-11-31(38-3)32(23-27)39-4)25-12-19-36(20-13-25)28-14-17-35(18-15-28)16-6-5-7-21-37-2/h8-11,22-23,25,28,34H,5-7,12-21H2,1-4H3 |
| InChIKey | ZQJSSFWAUPDPRE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|