C15H19N5 — CID 142347682
2-N-(4-piperidin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 142347682) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-N-(4-piperidin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-piperidin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142347682 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-N-(4-piperidin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(C3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C15H19N5/c16-14-7-10-18-15(20-14)19-13-3-1-11(2-4-13)12-5-8-17-9-6-12/h1-4,7,10,12,17H,5-6,8-9H2,(H3,16,18,19,20) |
| InChIKey | TYAHRAJLZVJPHZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |