C22H24ClN5O3S — CID 44898794
5-chloro-N-[2-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-2-nitrobenzamide (PubChem CID 44898794) has the molecular formula C22H24ClN5O3S and a molecular weight of 473.99 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[2-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 44898794 |
| Molecular Formula | C22H24ClN5O3S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 5-chloro-N-[2-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-2-nitrobenzamide |
| SMILES | Cc1ccc2sc(N3CCN(CCNC(=O)c4cc(Cl)ccc4[N+](=O)[O-])CC3)nc2c1C |
| InChI | InChI=1S/C22H24ClN5O3S/c1-14-3-6-19-20(15(14)2)25-22(32-19)27-11-9-26(10-12-27)8-7-24-21(29)17-13-16(23)4-5-18(17)28(30)31/h3-6,13H,7-12H2,1-2H3,(H,24,29) |
| InChIKey | KPMRRIOADZTXAD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|