C16H23Cl5N2O — CID 34315492
cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]cyclopropane-1-carboxamide (PubChem CID 34315492) has the molecular formula C16H23Cl5N2O and a molecular weight of 436.64 g/mol. Its IUPAC name is cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 34315492 |
| Molecular Formula | C16H23Cl5N2O |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)N[C@@H](NC1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H23Cl5N2O/c1-15(2)10(8-11(17)18)12(15)13(24)23-14(16(19,20)21)22-9-6-4-3-5-7-9/h8-10,12,14,22H,3-7H2,1-2H3,(H,23,24)/t10-,12+,14-/m1/s1 |
| InChIKey | KBOJCECEPHHEFJ-SCDSUCTJSA-N |
| XLogP | 5.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|