C14H19Cl5N2O3S — CID 51665650
cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl]cyclopropane-1-carboxamide (PubChem CID 51665650) has the molecular formula C14H19Cl5N2O3S and a molecular weight of 472.65 g/mol. Its IUPAC name is cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51665650 |
| Molecular Formula | C14H19Cl5N2O3S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)N[C@H](N[C@@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl5N2O3S/c1-13(2)8(5-9(15)16)10(13)11(22)21-12(14(17,18)19)20-7-3-4-25(23,24)6-7/h5,7-8,10,12,20H,3-4,6H2,1-2H3,(H,21,22)/t7-,8-,10+,12+/m1/s1 |
| InChIKey | PQQBTPDXIOBJKA-LBRZWBMMSA-N |
| XLogP | 3.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|