C13H18Cl3N2O2S+ — CID 7322717
N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]thiophene-2-carboxamide (PubChem CID 7322717) has the molecular formula C13H18Cl3N2O2S+ and a molecular weight of 372.73 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7322717 |
| Molecular Formula | C13H18Cl3N2O2S+ |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]thiophene-2-carboxamide |
| SMILES | C[C@@H]1C[NH+]([C@H](NC(=O)c2cccs2)C(Cl)(Cl)Cl)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H17Cl3N2O2S/c1-8-6-18(7-9(2)20-8)12(13(14,15)16)17-11(19)10-4-3-5-21-10/h3-5,8-9,12H,6-7H2,1-2H3,(H,17,19)/p+1/t8-,9-,12+/m1/s1 |
| InChIKey | WIQPPJCPSAIQSO-LNLATYFQSA-O |
| XLogP | 1.87 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|