C14H12Cl2N4OS — CID 18770520
N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]thiophene-2-carboxamide (PubChem CID 18770520) has the molecular formula C14H12Cl2N4OS and a molecular weight of 355.25 g/mol. Its IUPAC name is N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18770520 |
| Molecular Formula | C14H12Cl2N4OS |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]thiophene-2-carboxamide |
| SMILES | CC(Cl)(Cl)C(NC(=O)c1cccs1)n1nnc2ccccc21 |
| InChI | InChI=1S/C14H12Cl2N4OS/c1-14(15,16)13(17-12(21)11-7-4-8-22-11)20-10-6-3-2-5-9(10)18-19-20/h2-8,13H,1H3,(H,17,21) |
| InChIKey | CNHUTVNHWMLSOI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|