C26H26N2O5 — CID 20589160
3-[[6-[4-(2,4-dimethylphenoxy)butylcarbamoyl]-5-hydroxynaphthalen-1-yl]amino]prop-2-ynoic acid (PubChem CID 20589160) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-[[6-[4-(2,4-dimethylphenoxy)butylcarbamoyl]-5-hydroxynaphthalen-1-yl]amino]prop-2-ynoic acid.
| Compound Name | 3-[[6-[4-(2,4-dimethylphenoxy)butylcarbamoyl]-5-hydroxynaphthalen-1-yl]amino]prop-2-ynoic acid |
|---|---|
| PubChem CID | 20589160 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-[[6-[4-(2,4-dimethylphenoxy)butylcarbamoyl]-5-hydroxynaphthalen-1-yl]amino]prop-2-ynoic acid |
| SMILES | Cc1ccc(OCCCCNC(=O)c2ccc3c(NC#CC(=O)O)cccc3c2O)c(C)c1 |
| InChI | InChI=1S/C26H26N2O5/c1-17-8-11-23(18(2)16-17)33-15-4-3-13-28-26(32)21-10-9-19-20(25(21)31)6-5-7-22(19)27-14-12-24(29)30/h5-11,16,27,31H,3-4,13,15H2,1-2H3,(H,28,32)(H,29,30) |
| InChIKey | RVJBGPATUUEJBA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|