C17H20N2O4 — CID 20778426
2-methylpropyl N-[5-hydroxy-6-(methylcarbamoyl)naphthalen-1-yl]carbamate (PubChem CID 20778426) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-methylpropyl N-[5-hydroxy-6-(methylcarbamoyl)naphthalen-1-yl]carbamate.
| Compound Name | 2-methylpropyl N-[5-hydroxy-6-(methylcarbamoyl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 20778426 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-methylpropyl N-[5-hydroxy-6-(methylcarbamoyl)naphthalen-1-yl]carbamate |
| SMILES | CNC(=O)c1ccc2c(NC(=O)OCC(C)C)cccc2c1O |
| InChI | InChI=1S/C17H20N2O4/c1-10(2)9-23-17(22)19-14-6-4-5-12-11(14)7-8-13(15(12)20)16(21)18-3/h4-8,10,20H,9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | VFAJVJMDJDEKNH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |