C31H40ClNO4 — CID 131717503
N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-4-chloro-5,11-dioxotricyclo[6.2.1.02,7]undeca-2(7),3-diene-3-carboxamide (PubChem CID 131717503) has the molecular formula C31H40ClNO4 and a molecular weight of 526.12 g/mol. Its IUPAC name is N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-4-chloro-5,11-dioxotricyclo[6.2.1.02,7]undeca-2(7),3-diene-3-carboxamide.
| Compound Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-4-chloro-5,11-dioxotricyclo[6.2.1.02,7]undeca-2(7),3-diene-3-carboxamide |
|---|---|
| PubChem CID | 131717503 |
| Molecular Formula | C31H40ClNO4 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-4-chloro-5,11-dioxotricyclo[6.2.1.02,7]undeca-2(7),3-diene-3-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)C2=C(Cl)C(=O)CC3=C2C2CCC3C2=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C31H40ClNO4/c1-7-30(3,4)18-10-13-24(22(16-18)31(5,6)8-2)37-15-9-14-33-29(36)26-25-20-12-11-19(28(20)35)21(25)17-23(34)27(26)32/h10,13,16,19-20H,7-9,11-12,14-15,17H2,1-6H3,(H,33,36) |
| InChIKey | OZFWLLDWWGKKPV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|